Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,3,8-Trimethyl-Naphthalene |
|---|---|
| Synonyms | Trimethyl Naphthalene; Trimethylnaphthalene |
| Molecular Structure |  |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 |
| CAS Registry Number | 17057-91-9 |
| EINECS | 241-121-0 |
| SMILES | C1=C(C)C=C(C2=C1C=CC=C2C)C |
| InChI | 1S/C13H14/c1-9-7-11(3)13-10(2)5-4-6-12(13)8-9/h4-8H,1-3H3 |
| InChIKey | XYTKCJHHXQVFCK-UHFFFAOYSA-N |
| Density | 0.988g/cm3 (Cal.) |
|---|---|
| Melting point | 48°C (Expl.) |
| Boiling point | 289.985°C at 760 mmHg (Cal.) |
| Flash point | 130.29°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,3,8-Trimethyl-Naphthalene |