Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,3,6-Trimethylnaphthalene |
|---|---|
| Synonyms | Nsc11848; Naphthalene, 2,3,6-Trimethyl-; Ai3-17611 |
| Molecular Structure |  |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 |
| CAS Registry Number | 829-26-5 |
| EINECS | 212-588-8 |
| SMILES | C1=C(C)C=CC2=C1C=C(C(=C2)C)C |
| InChI | 1S/C13H14/c1-9-4-5-12-7-10(2)11(3)8-13(12)6-9/h4-8H,1-3H3 |
| InChIKey | UNBZRJCHIWTUHB-UHFFFAOYSA-N |
| Density | 0.988g/cm3 (Cal.) |
|---|---|
| Boiling point | 263.499°C at 760 mmHg (Cal.) |
| Flash point | 129.561°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,6-Trimethylnaphthalene |