Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-(Trifluoroacetyl)Benzamide |
|---|---|
| Synonyms | 4-(2,2,2-trifluoroacetyl)benzamide |
| Molecular Structure |  |
| Molecular Formula | C9H6F3NO2 |
| Molecular Weight | 217.14 |
| CAS Registry Number | 171555-54-7 |
| SMILES | c1cc(ccc1C(=O)C(F)(F)F)C(=O)N |
| InChI | 1S/C9H6F3NO2/c10-9(11,12)7(14)5-1-3-6(4-2-5)8(13)15/h1-4H,(H2,13,15) |
| InChIKey | BKUXJNOUINPCNA-UHFFFAOYSA-N |
| Density | 1.391g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.311°C at 760 mmHg (Cal.) |
| Flash point | 149.333°C (Cal.) |
| Refractive index | 1.497 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Trifluoroacetyl)Benzamide |