Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-(Trifluoroacetyl)-2-azabicyclo[2.2.1]heptane-3-carbaldehyde |
|---|---|
| Synonyms | 2-(2,2,2- |
| Molecular Structure | ![CAS#: 92591-89-4， 2-(Trifluoroacetyl)-2-azabicyclo[2.2.1]heptane-3-carbaldehyde](/moreStructures/92591-89-4.gif) |
| Molecular Formula | C9H10F3NO2 |
| Molecular Weight | 221.18 |
| CAS Registry Number | 92591-89-4 |
| SMILES | C1CC2CC1C(N2C(=O)C(F)(F)F)C=O |
| InChI | 1S/C9H10F3NO2/c10-9(11,12)8(15)13-6-2-1-5(3-6)7(13)4-14/h4-7H,1-3H2 |
| InChIKey | GJJPBNCJKNQLOH-UHFFFAOYSA-N |
| Density | 1.47g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.13°C at 760 mmHg (Cal.) |
| Flash point | 154.062°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Trifluoroacetyl)-2-azabicyclo[2.2.1]heptane-3-carbaldehyde |