Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Lup-20(29)-Ene |
|---|---|
| Synonyms | LUP-20(29)-ENE |
| Molecular Structure |  |
| Molecular Formula | C30H50 |
| Molecular Weight | 410.72 |
| CAS Registry Number | 1721-81-9 |
| SMILES | CC(=C)[C@@H]4CC[C@]5(C)CC[C@]3(C)[C@H](CC[C@H]2[C@@]3(C)CC[C@@H]1[C@]2(C)CCC[C@]1(C)C)[C@@H]45 |
| InChI | 1S/C30H50/c1-20(2)21-12-16-27(5)18-19-29(7)22(25(21)27)10-11-24-28(6)15-9-14-26(3,4)23(28)13-17-30(24,29)8/h21-25H,1,9-19H2,2-8H3/t21-,22+,23-,24+,25+,27+,28-,29+,30+/m0/s1 |
| InChIKey | CMMUMPUVMQKMLU-VIUFNMEASA-N |
| Density | 0.934g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.695°C at 760 mmHg (Cal.) |
| Flash point | 231.148°C (Cal.) |
| Refractive index | 1.504 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lup-20(29)-Ene |