Online Database of Chemicals from Around the World
|
CAS#: 61229-18-3 Product: Lup-20(29)-ene-3,16,28-triol No suppilers available for the product. |
| Name | Lup-20(29)-ene-3,16,28-triol |
|---|---|
| Synonyms | Lupene Triol; Nsc294921; Nsc 294921 |
| Molecular Structure |  |
| Molecular Formula | C30H50O3 |
| Molecular Weight | 458.72 |
| CAS Registry Number | 61229-18-3 |
| SMILES | C(C45C(CC3(C2(C(C1(CCC(C(C1CC2)(C)C)O)C)CCC3C4C(CC5)C(=C)C)C)C)O)O |
| InChI | 1S/C30H50O3/c1-18(2)19-10-15-30(17-31)24(33)16-29(7)20(25(19)30)8-9-22-27(5)13-12-23(32)26(3,4)21(27)11-14-28(22,29)6/h19-25,31-33H,1,8-17H2,2-7H3 |
| InChIKey | TWKNDDJHVQUEJF-UHFFFAOYSA-N |
| Density | 1.062g/cm3 (Cal.) |
|---|---|
| Boiling point | 552.852°C at 760 mmHg (Cal.) |
| Flash point | 225.295°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lup-20(29)-ene-3,16,28-triol |