Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Sodium 2-Nitrobenzoate |
|---|---|
| Synonyms | 2-Nitrobenzoic acid sodium salt; benzoic acid, 2-nitro-, sodium salt; sodium nitrobenzoate |
| Molecular Structure |  |
| Molecular Formula | C7H4NNaO4 |
| Molecular Weight | 189.10 |
| CAS Registry Number | 17264-82-3 |
| SMILES | [Na+].O=[N+]([O-])c1ccccc1C([O-])=O |
| InChI | 1S/C7H5NO4.Na/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10);/q;+1/p-1 |
| InChIKey | YEDBDKITOXSHCO-UHFFFAOYSA-M |
| Boiling point | 340.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 157.5°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 2-Nitrobenzoate |