Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 5-Ethyl-2,3,4,5-Tetramethylcyclohexen-1-One |
|---|---|
| Synonyms | 5-Ethyl-2,3,4,5-Tetramethyl-Cyclohex-2-En-1-One; 5-Ethyl-2,3,4,5-Tetramethyl-1-Cyclohex-2-Enone; 5-Ethyl-2,3,4,5-Tetramethyl-2-Cyclohexen-1-One |
| Molecular Structure |  |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 |
| CAS Registry Number | 17369-60-7 |
| EINECS | 241-403-3 |
| FEMA | 3061 |
| SMILES | C(C1(C(C(=C(C(=O)C1)C)C)C)C)C |
| InChI | 1S/C12H20O/c1-6-12(5)7-11(13)9(3)8(2)10(12)4/h10H,6-7H2,1-5H3 |
| InChIKey | WVMYETLAAOQTLM-UHFFFAOYSA-N |
| Density | 0.866g/cm3 (Cal.) |
|---|---|
| Boiling point | 245.791°C at 760 mmHg (Cal.) |
| Flash point | 106.719°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Ethyl-2,3,4,5-Tetramethylcyclohexen-1-One |