Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Ethyl 2,3,6,6-Tetramethylcyclohex-2-Ene-1-Carboxylate |
|---|---|
| Synonyms | 2,3,6,6-Tetramethyl-1-Cyclohex-2-Enecarboxylic Acid Ethyl Ester; 2,3,6,6-Tetramethylcyclohex-2-Ene-1-Carboxylic Acid Ethyl Ester; 2-Cyclohexene-1-Carboxylic Acid, 2,3,6,6-Tetramethyl-, Ethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 |
| CAS Registry Number | 77851-07-1 |
| EINECS | 278-776-7 |
| SMILES | C(OC(=O)C1C(CCC(=C1C)C)(C)C)C |
| InChI | 1S/C13H22O2/c1-6-15-12(14)11-10(3)9(2)7-8-13(11,4)5/h11H,6-8H2,1-5H3 |
| InChIKey | GUAPMIRFNRZYFI-UHFFFAOYSA-N |
| Density | 0.921g/cm3 (Cal.) |
|---|---|
| Boiling point | 251.119°C at 760 mmHg (Cal.) |
| Flash point | 97.189°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2,3,6,6-Tetramethylcyclohex-2-Ene-1-Carboxylate |