Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-[(2-Nitrophenyl)Sulfonyl]-1H-Indole |
|---|---|
| Synonyms | 1-((2-Nitrophenyl)Sulfonyl)-1H-Indole; 1H-Indole, 1-((2-Nitrophenyl)Sulfonyl)-; 1-[(2-Nitrophenyl)Sulfonyl]-1H-Indole |
| Molecular Structure | ![CAS#: 173908-24-2， 1-[(2-Nitrophenyl)Sulfonyl]-1H-Indole](/moreStructures/173908-24-2.gif) |
| Molecular Formula | C14H10N2O4S |
| Molecular Weight | 302.30 |
| CAS Registry Number | 173908-24-2 |
| SMILES | C1=CC3=C([N]1[S](=O)(=O)C2=CC=CC=C2[N+]([O-])=O)C=CC=C3 |
| InChI | 1S/C14H10N2O4S/c17-16(18)13-7-3-4-8-14(13)21(19,20)15-10-9-11-5-1-2-6-12(11)15/h1-10H |
| InChIKey | HUQBHLJAJLUOMR-UHFFFAOYSA-N |
| Density | 1.447g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.794°C at 760 mmHg (Cal.) |
| Flash point | 274.815°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(2-Nitrophenyl)Sulfonyl]-1H-Indole |