| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Vitas-M | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Phenylalanine derivatives |
|---|---|
| Name | N-[(4-Nitrophenyl)sulfonyl]-L-phenylalanine |
| Synonyms | N-(4-Nitrophenylsulfonyl)-L-phenylalanine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14N2O6S |
| Molecular Weight | 350.35 |
| CAS Registry Number | 64501-87-7 |
| SMILES | [O-][N+](=O)c1ccc(cc1)S(=O)(=O)N[C@H](C(=O)O)Cc2ccccc2 |
| InChI | 1S/C15H14N2O6S/c18-15(19)14(10-11-4-2-1-3-5-11)16-24(22,23)13-8-6-12(7-9-13)17(20)21/h1-9,14,16H,10H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | JVHRPLXWZFPXIJ-AWEZNQCLSA-N |
| Density | 1.456g/cm3 (Cal.) |
|---|---|
| Melting point | 169°C (Expl.) |
| Boiling point | 582.733°C at 760 mmHg (Cal.) |
| Flash point | 306.226°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-[(4-Nitrophenyl)sulfonyl]-L-phenylalanine |