Online Database of Chemicals from Around the World
| Name | 1-Anthracenesulfonyl Chloride |
|---|---|
| Synonyms | 1-Anthracenesulfonyl Chloride; Nsc140269 |
| Molecular Structure |  |
| Molecular Formula | C14H9ClO2S |
| Molecular Weight | 276.74 |
| CAS Registry Number | 17407-97-5 |
| SMILES | C3=C([S](=O)(=O)Cl)C2=C(C=C1C=CC=CC1=C2)C=C3 |
| InChI | 1S/C14H9ClO2S/c15-18(16,17)14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9H |
| InChIKey | BQPJFNZAKMDFBG-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.477°C at 760 mmHg (Cal.) |
| Flash point | 220.798°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Anthracenesulfonyl Chloride |
