Online Database of Chemicals from Around the World
|
CAS#: 70411-24-4 Product: Anthracene 1,2-Oxide No suppilers available for the product. |
| Name | Anthracene 1,2-Oxide |
|---|---|
| Synonyms | Anthracene 1,2-Oxide |
| Molecular Structure |  |
| Molecular Formula | C14H10O |
| Molecular Weight | 194.23 |
| CAS Registry Number | 70411-24-4 |
| SMILES | C1=C4C(=CC3=C1C2OC2C=C3)C=CC=C4 |
| InChI | 1S/C14H10O/c1-2-4-10-8-12-11(7-9(10)3-1)5-6-13-14(12)15-13/h1-8,13-14H |
| InChIKey | YDFLROSXCLHLJV-UHFFFAOYSA-N |
| Density | 1.266g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.032°C at 760 mmHg (Cal.) |
| Flash point | 174.619°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Anthracene 1,2-Oxide |