Online Database of Chemicals from Around the World
|
CAS#: 17408-50-3 Product: N,N'-Ethylenebis(2,2,2-Trichloroacetamide) No suppilers available for the product. |
| Name | N,N'-Ethylenebis(2,2,2-Trichloroacetamide) |
|---|---|
| Synonyms | 2,2,2-Trichloro-N-[2-[(2,2,2-Trichloro-1-Oxoethyl)Amino]Ethyl]Acetamide; 2,2,2-Trichloro-N-[2-(2,2,2-Trichloroethanoylamino)Ethyl]Ethanamide; Acetamide, N,N'-Ethylenebis(2,2,2-Trichloro- |
| Molecular Structure |  |
| Molecular Formula | C6H6Cl6N2O2 |
| Molecular Weight | 350.84 |
| CAS Registry Number | 17408-50-3 |
| SMILES | C(CNC(=O)C(Cl)(Cl)Cl)NC(=O)C(Cl)(Cl)Cl |
| InChI | 1S/C6H6Cl6N2O2/c7-5(8,9)3(15)13-1-2-14-4(16)6(10,11)12/h1-2H2,(H,13,15)(H,14,16) |
| InChIKey | RWNYTJHBXNDUAB-UHFFFAOYSA-N |
| Density | 1.688g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.513°C at 760 mmHg (Cal.) |
| Flash point | 223.239°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N'-Ethylenebis(2,2,2-Trichloroacetamide) |