| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | (6aR,10aR)-1-Methoxy-6,6-Dimethyl-9-Methylene-3-(2-Methyl-2-Octanyl)-6A,7,8,9,10,10A-Hexahydro-6H-Benzo[c]Chromene |
|---|---|
| Synonyms | (6aR,10aR |
| Molecular Structure | ![]() |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.59 |
| CAS Registry Number | 174627-56-6 |
| SMILES | CCCCCCC(C)(C)C1=CC2=C([C@@H]3CC(=C)CC[C@H]3C(O2)(C)C)C(=C1)OC |
| InChI | 1S/C26H40O2/c1-8-9-10-11-14-25(3,4)19-16-22(27-7)24-20-15-18(2)12-13-21(20)26(5,6)28-23(24)17-19/h16-17,20-21H,2,8-15H2,1,3-7H3/t20-,21-/m1/s1 |
| InChIKey | BJIIKHXAZBTGLF-NHCUHLMSSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.3±45.0°C at 760 mmHg (Cal.) |
| Flash point | 134.5±28.3°C (Cal.) |
| Refractive index | 1.523 (Cal.) |
| solubility | Soluble to 100 mM in DMSO and to 100 mM in ethanol |
| Market Analysis Reports |
| List of Reports Available for (6aR,10aR)-1-Methoxy-6,6-Dimethyl-9-Methylene-3-(2-Methyl-2-Octanyl)-6A,7,8,9,10,10A-Hexahydro-6H-Benzo[c]Chromene |