Online Database of Chemicals from Around the World
|
CAS#: 79664-58-7 Product: 7-Methoxy-1,6-Dimethylisoquinoline-5,8-Dione No suppilers available for the product. |
| Name | 7-Methoxy-1,6-Dimethylisoquinoline-5,8-Dione |
|---|---|
| Synonyms | 7-Methoxy-1,6-Dimethyl-Isoquinoline-5,8-Dione; 7-Methoxy-1,6-Dimethyl-Isoquinoline-5,8-Quinone; Inchi=1/C12h11no3/C1-6-10(14)8-4-5-13-7(2)9(8)11(15)12(6)16-3/H4-5H,1-3H |
| Molecular Structure |  |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 |
| CAS Registry Number | 79664-58-7 |
| SMILES | C1=CN=C(C2=C1C(=O)C(=C(OC)C2=O)C)C |
| InChI | 1S/C12H11NO3/c1-6-10(14)8-4-5-13-7(2)9(8)11(15)12(6)16-3/h4-5H,1-3H3 |
| InChIKey | CYEQNCOGYHCBOC-UHFFFAOYSA-N |
| Density | 1.265g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.376°C at 760 mmHg (Cal.) |
| Flash point | 194.731°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Methoxy-1,6-Dimethylisoquinoline-5,8-Dione |