Online Database of Chemicals from Around the World
|
CAS#: 17526-17-9 Product: Lucidin Ethyl Ether No suppilers available for the product. |
| Name | Lucidin Ethyl Ether |
|---|---|
| Synonyms | 2-(Ethoxymethyl)-1,3-Dihydroxy-Anthracene-9,10-Dione; 2-(Ethoxymethyl)-1,3-Dihydroxy-9,10-Anthraquinone; 1,3-Dihydroxy-2-Ethoxymethylanthraquinone |
| Molecular Structure |  |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 |
| CAS Registry Number | 17526-17-9 |
| SMILES | C1=C(C(=C(C2=C1C(=O)C3=C(C2=O)C=CC=C3)O)COCC)O |
| InChI | 1S/C17H14O5/c1-2-22-8-12-13(18)7-11-14(17(12)21)16(20)10-6-4-3-5-9(10)15(11)19/h3-7,18,21H,2,8H2,1H3 |
| InChIKey | VRARPPQMEQUQET-UHFFFAOYSA-N |
| Density | 1.41g/cm3 (Cal.) |
|---|---|
| Boiling point | 540.602°C at 760 mmHg (Cal.) |
| Flash point | 203.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lucidin Ethyl Ether |