Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (S)-alpha-Chloro-1H-Imidazole-4-Propanoicacid |
|---|---|
| Synonyms | 2-Chloro-3-(3H-Imidazol-4-Yl)Propionic Acid; Alpha-Chloro-Beta-Imidazol-4(5)-Ylpropionic Acid; Nsc315287 |
| Molecular Structure |  |
| Molecular Formula | C6H7ClN2O2 |
| Molecular Weight | 174.59 |
| CAS Registry Number | 17561-26-1 |
| SMILES | C1=NC=C(CC(Cl)C(=O)O)[NH]1 |
| InChI | 1S/C6H7ClN2O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1H2,(H,8,9)(H,10,11) |
| InChIKey | JZLQYMHAXPPICX-UHFFFAOYSA-N |
| Density | 1.496g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.204°C at 760 mmHg (Cal.) |
| Flash point | 226.68°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (S)-alpha-Chloro-1H-Imidazole-4-Propanoicacid |