Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Chlorohyssopifolin B |
|---|---|
| Synonyms | (3Ar,4S,6Ar,8S,9S,9As,9Bs)-9-(Chloromethyl)-4,8,9-Trihydroxy-3,6-Dimethylene-3A,4,5,6A,7,8,9A,9B-Octahydroazuleno[5,4-D]Furan-2-One; Azuleno(4,5-B)Furan-2(3H)-One, Decahydro-3,6-Bis(Methylene)-9-(Chloromethyl)-4,8,9-Trihydroxy-, (3Ar-(3A-Alpha,4-Alpha,6A-Alpha,8-Beta,9-Alpha,9A-Alpha,9B-Beta))-; Chlorohyssopifolin B |
| Molecular Structure |  |
| Molecular Formula | C15H19ClO5 |
| Molecular Weight | 314.77 |
| CAS Registry Number | 38290-03-8 |
| SMILES | [C@@H]23[C@@H]1[C@H](C(=C)C(O1)=O)[C@@H](O)CC([C@@H]2C[C@@H]([C@]3(O)CCl)O)=C |
| InChI | 1S/C15H19ClO5/c1-6-3-9(17)11-7(2)14(19)21-13(11)12-8(6)4-10(18)15(12,20)5-16/h8-13,17-18,20H,1-5H2/t8-,9-,10-,11+,12-,13-,15+/m0/s1 |
| InChIKey | YIFQICREHIVCKL-YWDFAVMRSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 544.137°C at 760 mmHg (Cal.) |
| Flash point | 282.884°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chlorohyssopifolin B |