Online Database of Chemicals from Around the World
|
CAS#: 17573-21-6 Product: 9-Hydroxybenzo(a)Pyrene No suppilers available for the product. |
| Name | 9-Hydroxybenzo(a)Pyrene |
|---|---|
| Synonyms | 9-Benzo[A]Pyrenol; 9-Hydroxybenzo[A]Pyrene; C14556 |
| Molecular Structure |  |
| Molecular Formula | C20H12O |
| Molecular Weight | 268.31 |
| CAS Registry Number | 17573-21-6 |
| SMILES | C1=C(O)C=CC2=C1C5=C3C(=C2)C=CC4=CC=CC(=C34)C=C5 |
| InChI | 1S/C20H12O/c21-16-8-6-14-10-15-5-4-12-2-1-3-13-7-9-17(18(14)11-16)20(15)19(12)13/h1-11,21H |
| InChIKey | OBBBXCAFTKLFGZ-UHFFFAOYSA-N |
| Density | 1.379g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.227°C at 760 mmHg (Cal.) |
| Flash point | 252.929°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Hydroxybenzo(a)Pyrene |