Online Database of Chemicals from Around the World
|
CAS#: 22717-94-8 Product: 2-Hydroxybenzo(c)Phenanthrene No suppilers available for the product. |
| Name | 2-Hydroxybenzo(c)Phenanthrene |
|---|---|
| Synonyms | 11-Benzo[C]Phenanthrenol; Benzo(C)Phenanthren-2-Ol; Nsc 97676 |
| Molecular Structure |  |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 |
| CAS Registry Number | 22717-94-8 |
| SMILES | C1=CC2=C(C=C1)C3=C(C=C2)C=CC4=CC=C(C=C34)O |
| InChI | 1S/C18H12O/c19-15-10-9-13-6-8-14-7-5-12-3-1-2-4-16(12)18(14)17(13)11-15/h1-11,19H |
| InChIKey | WCFYKAAKPJSBFZ-UHFFFAOYSA-N |
| Density | 1.284g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.238°C at 760 mmHg (Cal.) |
| Flash point | 240.379°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxybenzo(c)Phenanthrene |