Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3-Fluoro-4-Nitro-Quinoline 1-Oxide |
|---|---|
| Synonyms | 3-Fluoro-4-Nitro-1-Oxido-Quinolin-1-Ium; 3-Fluoro-4-Nitroquinoline 1-Oxide; Brn 1315880 |
| Molecular Structure |  |
| Molecular Formula | C9H5FN2O3 |
| Molecular Weight | 208.15 |
| CAS Registry Number | 17576-63-5 |
| SMILES | C1=C(C(=C2C(=[N+]1[O-])C=CC=C2)[N+]([O-])=O)F |
| InChI | 1S/C9H5FN2O3/c10-7-5-11(13)8-4-2-1-3-6(8)9(7)12(14)15/h1-5H |
| InChIKey | NMFUNZZDIKAODM-UHFFFAOYSA-N |
| Density | 1.521g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.302°C at 760 mmHg (Cal.) |
| Flash point | 197.71°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Fluoro-4-Nitro-Quinoline 1-Oxide |