|
CAS#: 343-26-0 Product: 6-Fluoro-8-Nitroquinoline No suppilers available for the product. |
| Name | 6-Fluoro-8-Nitroquinoline |
|---|---|
| Synonyms | 6-Fluoro-8-Nitro-Quinoline; Quinoline, 6-Fluoro-8-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H5FN2O2 |
| Molecular Weight | 192.15 |
| CAS Registry Number | 343-26-0 |
| SMILES | C1=C(F)C=C2C(=C1[N+]([O-])=O)N=CC=C2 |
| InChI | 1S/C9H5FN2O2/c10-7-4-6-2-1-3-11-9(6)8(5-7)12(13)14/h1-5H |
| InChIKey | LDSAYITYLRHGQV-UHFFFAOYSA-N |
| Density | 1.447g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.015°C at 760 mmHg (Cal.) |
| Flash point | 151.574°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 6-Fluoro-8-Nitroquinoline |