Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 2,4-Dichloro-m-Cresol |
|---|---|
| Synonyms | 2,4-Dichloro-3-Methyl-Phenol; Inchi=1/C7h6cl2o/C1-4-5(8)2-3-6(10)7(4)9/H2-3,10H,1H; 2,4-Dichloro-M-Cresol |
| Molecular Structure |  |
| Molecular Formula | C7H6Cl2O |
| Molecular Weight | 177.03 |
| CAS Registry Number | 17788-00-0 |
| EINECS | 241-765-2 |
| SMILES | C1=C(C(=C(C(=C1)O)Cl)C)Cl |
| InChI | 1S/C7H6Cl2O/c1-4-5(8)2-3-6(10)7(4)9/h2-3,10H,1H3 |
| InChIKey | GIXSFSVVKULPEK-UHFFFAOYSA-N |
| Density | 1.383g/cm3 (Cal.) |
|---|---|
| Boiling point | 243.87°C at 760 mmHg (Cal.) |
| Flash point | 108.249°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dichloro-m-Cresol |