Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3,6-Dichloro-4(1H)-cinnolinone |
|---|---|
| Synonyms | 3,6-dichlorocinnolin-4-ol; 4-Cinnolinol, 3,6-dichloro- |
| Molecular Structure |  |
| Molecular Formula | C8H4Cl2N2O |
| Molecular Weight | 215.04 |
| CAS Registry Number | 872285-09-1 |
| SMILES | Clc1ccc2N\N=C(\Cl)C(=O)c2c1 |
| InChI | 1S/C8H4Cl2N2O/c9-4-1-2-6-5(3-4)7(13)8(10)12-11-6/h1-3H,(H,11,13) |
| InChIKey | GSWGNRJMVDIEBD-UHFFFAOYSA-N |
| Density | 1.659g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.855°C at 760 mmHg (Cal.) |
| Flash point | 181.111°C (Cal.) |
| Refractive index | 1.707 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,6-Dichloro-4(1H)-cinnolinone |