Online Database of Chemicals from Around the World
|
CAS#: 17841-75-7 Product: Dimethyl-Bis(Phenylmethyl)Stannane No suppilers available for the product. |
| Name | Dimethyl-Bis(Phenylmethyl)Stannane |
|---|---|
| Synonyms | Bis(Benzyl)-Dimethyl-Stannane; Nsc22327 |
| Molecular Structure |  |
| Molecular Formula | C16H20Sn |
| Molecular Weight | 331.02 |
| CAS Registry Number | 17841-75-7 |
| SMILES | C1=CC=CC=C1C[Sn](C)(C)CC2=CC=CC=C2 |
| InChI | 1S/2C7H7.2CH3.Sn/c2*1-7-5-3-2-4-6-7;;;/h2*2-6H,1H2;2*1H3; |
| InChIKey | SBPVNOJMOXZFTL-UHFFFAOYSA-N |
| Boiling point | 360.826°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 176.279°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl-Bis(Phenylmethyl)Stannane |