Online Database of Chemicals from Around the World
|
CAS#: 32555-34-3 Product: N,N-Dimethyl-1,1-Bis(Phenoxy)Ethanamine No suppilers available for the product. |
| Name | N,N-Dimethyl-1,1-Bis(Phenoxy)Ethanamine |
|---|---|
| Synonyms | 1,1-Bis(Phenoxy)Ethyl-Dimethyl-Amine; Diphenoxyethyl(Dimethyl)Amine |
| Molecular Structure |  |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 |
| CAS Registry Number | 32555-34-3 |
| EINECS | 251-096-8 |
| SMILES | C2=C(OC(OC1=CC=CC=C1)(N(C)C)C)C=CC=C2 |
| InChI | 1S/C16H19NO2/c1-16(17(2)3,18-14-10-6-4-7-11-14)19-15-12-8-5-9-13-15/h4-13H,1-3H3 |
| InChIKey | ZOONQADLXWDSMG-UHFFFAOYSA-N |
| Density | 1.078g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.314°C at 760 mmHg (Cal.) |
| Flash point | 129.344°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-1,1-Bis(Phenoxy)Ethanamine |