Online Database of Chemicals from Around the World
| Florida Center for Heterocyclic Compounds | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (352) 392-0554 | |||
 |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | Trimethyl-(4-Methylphenoxy)Silane |
|---|---|
| Synonyms | 4-Methylphenyl Trimethylsilyl Ether; Nsc146162; Silane, Trimethyl(4-Methylphenoxy)- |
| Molecular Structure |  |
| Molecular Formula | C10H16OSi |
| Molecular Weight | 180.32 |
| CAS Registry Number | 17902-32-8 |
| SMILES | C1=C(O[Si](C)(C)C)C=CC(=C1)C |
| InChI | 1S/C10H16OSi/c1-9-5-7-10(8-6-9)11-12(2,3)4/h5-8H,1-4H3 |
| InChIKey | KWNZPYGXIBVQKX-UHFFFAOYSA-N |
| Density | 0.909g/cm3 (Cal.) |
|---|---|
| Boiling point | 198.735°C at 760 mmHg (Cal.) |
| Flash point | 66.204°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethyl-(4-Methylphenoxy)Silane |