Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N2,N2,2-Trimethyl-N-(2-methylphenyl)alaninamide |
|---|---|
| Synonyms | 2-(dimethylamino)-2-methyl-N-(o-tolyl)propanamide |
| Molecular Structure |  |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.31 |
| CAS Registry Number | 802022-02-2 |
| SMILES | Cc1ccccc1NC(=O)C(C)(C)N(C)C |
| InChI | 1S/C13H20N2O/c1-10-8-6-7-9-11(10)14-12(16)13(2,3)15(4)5/h6-9H,1-5H3,(H,14,16) |
| InChIKey | XMTZLWUYXUGPTB-UHFFFAOYSA-N |
| Density | 1.039g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.853°C at 760 mmHg (Cal.) |
| Flash point | 159.942°C (Cal.) |
| Refractive index | 1.55 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N2,N2,2-Trimethyl-N-(2-methylphenyl)alaninamide |