Online Database of Chemicals from Around the World
|
CAS#: 17948-33-3 Product: Rutacridone No suppilers available for the product. |
| Name | Rutacridone |
|---|---|
| Synonyms | Nsc628875; (-)-Rutacridone; Brn 1086707 |
| Molecular Structure |  |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 |
| CAS Registry Number | 17948-33-3 |
| SMILES | C3=C(O)C2=C(N(C1=CC=CC=C1C2=O)C)C4=C3OC(C4)C(=C)C |
| InChI | 1S/C19H17NO3/c1-10(2)15-8-12-16(23-15)9-14(21)17-18(12)20(3)13-7-5-4-6-11(13)19(17)22/h4-7,9,15,21H,1,8H2,2-3H3 |
| InChIKey | FHAGACMCMQYSNX-UHFFFAOYSA-N |
| Density | 1.293g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.981°C at 760 mmHg (Cal.) |
| Flash point | 277.347°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Rutacridone |