Online Database of Chemicals from Around the World
|
CAS#: 77996-03-3 Product: Rutacridone epoxide No suppilers available for the product. |
| Name | Rutacridone epoxide |
|---|---|
| Synonyms | 5-Hydroxy-11-Methyl-2-(2-Methyl-2-Oxiranyl)-1,11-Dihydrofuro[2,3-C]Acridin-6(2H)-One; Aids-130215; Aids130215 |
| Molecular Structure |  |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 |
| CAS Registry Number | 77996-03-3 |
| SMILES | C3=C(C2=C(N(C)C1=CC=CC=C1C2=O)C5=C3OC(C4(OC4)C)C5)O |
| InChI | 1S/C19H17NO4/c1-19(9-23-19)15-7-11-14(24-15)8-13(21)16-17(11)20(2)12-6-4-3-5-10(12)18(16)22/h3-6,8,15,21H,7,9H2,1-2H3 |
| InChIKey | YXQGLAPCZDYVLL-UHFFFAOYSA-N |
| Density | 1.415g/cm3 (Cal.) |
|---|---|
| Boiling point | 565.623°C at 760 mmHg (Cal.) |
| Flash point | 295.878°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Rutacridone epoxide |