Online Database of Chemicals from Around the World
|
CAS#: 18001-76-8 Product: 1,1,2,2-Tetraethoxy-1,2-Dimethyldisilane No suppilers available for the product. |
| Name | 1,1,2,2-Tetraethoxy-1,2-Dimethyldisilane |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C10H26O4Si2 |
| Molecular Weight | 266.48 |
| CAS Registry Number | 18001-76-8 |
| SMILES | O(CC)[Si](OCC)([Si](OCC)(OCC)C)C |
| InChI | 1S/C10H26O4Si2/c1-7-11-15(5,12-8-2)16(6,13-9-3)14-10-4/h7-10H2,1-6H3 |
| InChIKey | VPLIEAVLKBXZCM-UHFFFAOYSA-N |
| Density | 0.917g/cm3 (Cal.) |
|---|---|
| Boiling point | 245.25°C at 760 mmHg (Cal.) |
| Flash point | 86.278°C (Cal.) |
| Refractive index | 1.415 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2-Tetraethoxy-1,2-Dimethyldisilane |