Online Database of Chemicals from Around the World
|
CAS#: 60144-50-5 Product: 5,12:6,11:13,16:14,15-Tetraethanotricyclo[8.2.2.24,7]Hexadecane-1(12),4,6,10,13,15-Hexene No suppilers available for the product. |
| Name | 5,12:6,11:13,16:14,15-Tetraethanotricyclo[8.2.2.24,7]Hexadecane-1(12),4,6,10,13,15-Hexene |
|---|---|
| Synonyms | [2.2.2.2.2.2](1,2,3,4,5,6)Cyclophane |
| Molecular Structure | ![CAS#: 60144-50-5， 5,12:6,11:13,16:14,15-Tetraethanotricyclo[8.2.2.24,7]Hexadecane-1(12),4,6,10,13,15-Hexene](/moreStructures/60144-50-5.gif) |
| Molecular Formula | C24H24 |
| Molecular Weight | 312.45 |
| CAS Registry Number | 60144-50-5 |
| SMILES | C3C1=C4C5=C6C7=C1CCC2=C(C(=C(C(=C2C3)CC4)CC5)CC6)CC7 |
| InChI | 1S/C24H24/c1-2-14-17-5-3-15-13(1)16-4-6-18(14)22-10-8-20(16)23-11-12-24(22)21(17)9-7-19(15)23/h1-12H2 |
| InChIKey | BVTYOCKAKQQPEE-UHFFFAOYSA-N |
| Density | 1.265g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.597°C at 760 mmHg (Cal.) |
| Flash point | 200.444°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,12:6,11:13,16:14,15-Tetraethanotricyclo[8.2.2.24,7]Hexadecane-1(12),4,6,10,13,15-Hexene |