Online Database of Chemicals from Around the World
|
CAS#: 18061-48-8 Product: 1-Acetoxy-4-Acetoxyimino-1,4-Dihydroquinoline No suppilers available for the product. |
| Name | 1-Acetoxy-4-Acetoxyimino-1,4-Dihydroquinoline |
|---|---|
| Synonyms | [(4E)-4-Acetyloxyiminoquinolin-1-Yl] Acetate; (4-Acetoxyimino-1-Quinolyl) Acetate; [(4E)-4-Acetoxyimino-1-Quinolyl] Acetate |
| Molecular Structure |  |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 |
| CAS Registry Number | 18061-48-8 |
| SMILES | C1=CC=CC/2=C1N(C=CC2=N/OC(C)=O)OC(C)=O |
| InChI | 1S/C13H12N2O4/c1-9(16)18-14-12-7-8-15(19-10(2)17)13-6-4-3-5-11(12)13/h3-8H,1-2H3/b14-12+ |
| InChIKey | HGGQOJCRQGAQBU-WYMLVPIESA-N |
| Density | 1.262g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.904°C at 760 mmHg (Cal.) |
| Flash point | 167.835°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Acetoxy-4-Acetoxyimino-1,4-Dihydroquinoline |