Online Database of Chemicals from Around the World
|
CAS#: 26541-56-0 Product: N-Acetoxy-4-Acetylaminobiphenyl No suppilers available for the product. |
| Name | N-Acetoxy-4-Acetylaminobiphenyl |
|---|---|
| Synonyms | Acetic Acid [Acetyl-(4-Phenylphenyl)Amino] Ester; [Ethanoyl-(4-Phenylphenyl)Amino] Ethanoate; N-Acetoxy-4-Acetamidobiphenyl |
| Molecular Structure |  |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 |
| CAS Registry Number | 26541-56-0 |
| SMILES | C1=C(N(OC(=O)C)C(=O)C)C=CC(=C1)C2=CC=CC=C2 |
| InChI | 1S/C16H15NO3/c1-12(18)17(20-13(2)19)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-11H,1-2H3 |
| InChIKey | UJDATCBZIHYYMW-UHFFFAOYSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.443°C at 760 mmHg (Cal.) |
| Flash point | 199.61°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetoxy-4-Acetylaminobiphenyl |