Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Ethyl N-Salicyloylanthranilate |
|---|---|
| Synonyms | 2-[[(2-Hydroxyphenyl)-Oxomethyl]Amino]Benzoic Acid Ethyl Ester; 2-[(2-Hydroxybenzoyl)Amino]Benzoic Acid Ethyl Ester; Ethyl 2-[(2-Hydroxyphenyl)Carbonylamino]Benzoate |
| Molecular Structure |  |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 |
| CAS Registry Number | 18066-04-1 |
| EINECS | 241-973-3 |
| SMILES | C1=CC=CC(=C1NC(=O)C2=C(O)C=CC=C2)C(OCC)=O |
| InChI | 1S/C16H15NO4/c1-2-21-16(20)11-7-3-5-9-13(11)17-15(19)12-8-4-6-10-14(12)18/h3-10,18H,2H2,1H3,(H,17,19) |
| InChIKey | IFSMESGPJPDOED-UHFFFAOYSA-N |
| Density | 1.29g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.351°C at 760 mmHg (Cal.) |
| Flash point | 184.435°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl N-Salicyloylanthranilate |