Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Ethyl (2E)-3-(2,3-Dihydroxyphenyl)Acrylate |
|---|---|
| Synonyms | (E)-ethyl 3-(2,3-dihydroxyphenyl)acrylate |
| Molecular Structure |  |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| CAS Registry Number | 180694-42-2 |
| SMILES | CCOC(=O)/C=C/c1cccc(c1O)O |
| InChI | 1S/C11H12O4/c1-2-15-10(13)7-6-8-4-3-5-9(12)11(8)14/h3-7,12,14H,2H2,1H3/b7-6+ |
| InChIKey | ZZYJOKQNMBINSS-VOTSOKGWSA-N |
| Density | 1.271g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.582°C at 760 mmHg (Cal.) |
| Flash point | 149.135°C (Cal.) |
| Refractive index | 1.612 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (2E)-3-(2,3-Dihydroxyphenyl)Acrylate |