Online Database of Chemicals from Around the World
|
CAS#: 18070-40-1 Product: Boschniakine No suppilers available for the product. |
| Name | Boschniakine |
|---|---|
| Synonyms | (7R)-7-Methyl-6,7-Dihydro-5H-Cyclopenta[D]Pyridine-4-Carboxaldehyde; (7R)-7-Methyl-2-Pyrindan-4-Carbaldehyde; Boschniakine |
| Molecular Structure |  |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 |
| CAS Registry Number | 18070-40-1 |
| SMILES | [C@@H]2(C1=CN=CC(=C1CC2)C=O)C |
| InChI | 1S/C10H11NO/c1-7-2-3-9-8(6-12)4-11-5-10(7)9/h4-7H,2-3H2,1H3/t7-/m1/s1 |
| InChIKey | OPRAONAUWNNOOV-SSDOTTSWSA-N |
| Density | 1.124g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.01°C at 760 mmHg (Cal.) |
| Flash point | 123.657°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Boschniakine |