Online Database of Chemicals from Around the World
|
CAS#: 18073-34-2 Product: 9-Bromoellipticine No suppilers available for the product. |
| Name | 9-Bromoellipticine |
|---|---|
| Synonyms | 6H-Pyrido[4,3-B]Carbazole, 9-Bromo-5,11-Dimethyl-; 9-Bromoellipticine; Ellipticine, 9-Bromo- |
| Molecular Structure |  |
| Molecular Formula | C17H13BrN2 |
| Molecular Weight | 325.21 |
| CAS Registry Number | 18073-34-2 |
| SMILES | C1=C(Br)C=CC2=C1C3=C([NH]2)C(=C4C(=C3C)C=NC=C4)C |
| InChI | 1S/C17H13BrN2/c1-9-14-8-19-6-5-12(14)10(2)17-16(9)13-7-11(18)3-4-15(13)20-17/h3-8,20H,1-2H3 |
| InChIKey | OSDDZVXUCKZOQA-UHFFFAOYSA-N |
| Density | 1.534g/cm3 (Cal.) |
|---|---|
| Boiling point | 539.359°C at 760 mmHg (Cal.) |
| Flash point | 279.994°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Bromoellipticine |