Online Database of Chemicals from Around the World
|
CAS#: 28507-02-0 Product: 16-Bromoepiandrosterone No suppilers available for the product. |
| Name | 16-Bromoepiandrosterone |
|---|---|
| Synonyms | 16-Br-Epi; 16-Bromoepiandrosterone; 16Alpha-Bromo-3Beta-Hydroxy-5Alpha-Androstan-17-One |
| Molecular Structure |  |
| Molecular Formula | C19H29BrO2 |
| Molecular Weight | 369.34 |
| CAS Registry Number | 28507-02-0 |
| SMILES | [C@H]13[C@@H]([C@@]2([C@@H](CC1)C[C@@H](O)CC2)C)CC[C@]4([C@H]3C[C@@H](Br)C4=O)C |
| InChI | 1S/C19H29BrO2/c1-18-7-5-12(21)9-11(18)3-4-13-14(18)6-8-19(2)15(13)10-16(20)17(19)22/h11-16,21H,3-10H2,1-2H3/t11-,12-,13+,14-,15-,16+,18-,19-/m0/s1 |
| InChIKey | CWVMWSZEMZOUPC-JUAXIXHSSA-N |
| Density | 1.31g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.561°C at 760 mmHg (Cal.) |
| Flash point | 225.082°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16-Bromoepiandrosterone |