Online Database of Chemicals from Around the World
| Name | Octahydro-1-(Trichloromethyl)Pentalene |
|---|---|
| Synonyms | Octahydro-1-(Trichloromethyl)Pentalene; Nsc79878 |
| Molecular Structure |  |
| Molecular Formula | C9H13Cl3 |
| Molecular Weight | 227.56 |
| CAS Registry Number | 18127-07-6 |
| EINECS | 242-017-8 |
| SMILES | C1C(C2C(C1)CCC2)C(Cl)(Cl)Cl |
| InChI | 1S/C9H13Cl3/c10-9(11,12)8-5-4-6-2-1-3-7(6)8/h6-8H,1-5H2 |
| InChIKey | ALVRJPFFWYTSIS-UHFFFAOYSA-N |
| Density | 1.309g/cm3 (Cal.) |
|---|---|
| Boiling point | 261.003°C at 760 mmHg (Cal.) |
| Flash point | 168.922°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Octahydro-1-(Trichloromethyl)Pentalene |
