Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 1-(1,2,3,5,6,7,8,8alpha-Octahydro-2,3,8,8-Tetramethyl-2-Naphthyl)Ethan-1-One |
|---|---|
| Synonyms | 1-(1,2,3,5,6,7,8,8A-Octahydro-2,3,8,8-Tetramethyl-2-Naphthyl)Ethan-1-One; Ethanone, 1-(1,2,3,5,6,7,8,8A-Octahydro-2,3,8,8-Tetramethyl-2-Naphthalenyl)- |
| Molecular Structure |  |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 |
| CAS Registry Number | 68155-66-8 |
| EINECS | 268-978-3 |
| SMILES | CC1(CCCC2=CC(C)C(C(=O)C)(C)CC12)C |
| InChI | 1S/C16H26O/c1-11-9-13-7-6-8-15(3,4)14(13)10-16(11,5)12(2)17/h9,11,14H,6-8,10H2,1-5H3 |
| InChIKey | NOMWSTMYQKABST-UHFFFAOYSA-N |
| Density | 0.949g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.393°C at 760 mmHg (Cal.) |
| Flash point | 127.242°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1,2,3,5,6,7,8,8alpha-Octahydro-2,3,8,8-Tetramethyl-2-Naphthyl)Ethan-1-One |