Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,1'-Biadamantane-3,3'-Diamine |
|---|---|
| Synonyms | 3-(3-Amino-1-Adamantyl)-1-Adamantanamine; [3-(3-Amino-1-Adamantyl)-1-Adamantyl]Amine; 1,1'-Biadamantane-3,3'-Diamine |
| Molecular Structure |  |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 |
| CAS Registry Number | 18220-68-3 |
| SMILES | NC46CC5(C12CC3(N)CC(C1)CC(C2)C3)CC(C4)CC(C5)C6 |
| InChI | 1S/C20H32N2/c21-19-7-13-1-14(8-19)4-17(3-13,11-19)18-5-15-2-16(6-18)10-20(22,9-15)12-18/h13-16H,1-12,21-22H2 |
| InChIKey | SOKRCBPOBAYQBS-UHFFFAOYSA-N |
| Density | 1.218g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.714°C at 760 mmHg (Cal.) |
| Flash point | 219.015°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-Biadamantane-3,3'-Diamine |