| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | API >> Antiparasitic drug >> Anti-amebiasis and anti-trichomoniasis drugs |
|---|---|
| Name | Bialamicol |
| Synonyms | 2-Allyl-4-[3-Allyl-5-(Diethylaminomethyl)-4-Hydroxy-Phenyl]-6-(Diethylaminomethyl)Phenol; 2-Allyl-4-[3-Allyl-5-(Diethylaminomethyl)-4-Hydroxyphenyl]-6-(Diethylaminomethyl)Phenol; 2-(Diethylaminomethyl)-4-[3-(Diethylaminomethyl)-4-Hydroxy-5-Prop-2-Enyl-Phenyl]-6-Prop-2-Enyl-Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C28H40N2O2 |
| Molecular Weight | 436.64 |
| CAS Registry Number | 493-75-4 |
| SMILES | C2=C(C1=CC(=C(O)C(=C1)CC=C)CN(CC)CC)C=C(CC=C)C(=C2CN(CC)CC)O |
| InChI | 1S/C28H40N2O2/c1-7-13-21-15-23(17-25(27(21)31)19-29(9-3)10-4)24-16-22(14-8-2)28(32)26(18-24)20-30(11-5)12-6/h7-8,15-18,31-32H,1-2,9-14,19-20H2,3-6H3 |
| InChIKey | DQNIWUUHJSXGHW-UHFFFAOYSA-N |
| Density | 1.041g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.576°C at 760 mmHg (Cal.) |
| Flash point | 206.623°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bialamicol |