|
CAS#: 182482-56-0 Product: 2-Isopropyl-4-Isopropylidene-2-Cyclohexen-1-Ol No suppilers available for the product. |
| Name | 2-Isopropyl-4-Isopropylidene-2-Cyclohexen-1-Ol |
|---|---|
| Synonyms | 2-CYCLOHEXEN-1-OL,2-(1-METHYLETHYL)-4-(1-METHYLETHYLIDENE)-; Canventol; DL-Canventol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 |
| CAS Registry Number | 182482-56-0 |
| SMILES | OC1C(=C\C(=C(/C)C)CC1)/C(C)C |
| InChI | 1S/C12H20O/c1-8(2)10-5-6-12(13)11(7-10)9(3)4/h7,9,12-13H,5-6H2,1-4H3 |
| InChIKey | CYOJESZRZNCQEV-UHFFFAOYSA-N |
| Density | 0.955g/cm3 (Cal.) |
|---|---|
| Boiling point | 171.901°C at 760 mmHg (Cal.) |
| Flash point | 65.334°C (Cal.) |
| Refractive index | 1.507 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Isopropyl-4-Isopropylidene-2-Cyclohexen-1-Ol |