Online Database of Chemicals from Around the World
|
CAS#: 18507-23-8 Product: N-Isopropyl-P-(Isopropylsulfonyl)Benzamide No suppilers available for the product. |
| Name | N-Isopropyl-P-(Isopropylsulfonyl)Benzamide |
|---|---|
| Synonyms | N-Isopropyl-4-Isopropylsulfonyl-Benzamide; N-Isopropyl-4-Isopropylsulfonylbenzamide; N-Propan-2-Yl-4-Propan-2-Ylsulfonyl-Benzamide |
| Molecular Structure |  |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.36 |
| CAS Registry Number | 18507-23-8 |
| SMILES | C1=CC(=CC=C1C(=O)NC(C)C)[S](=O)(=O)C(C)C |
| InChI | 1S/C13H19NO3S/c1-9(2)14-13(15)11-5-7-12(8-6-11)18(16,17)10(3)4/h5-10H,1-4H3,(H,14,15) |
| InChIKey | ALQNJBZDGUJPIG-UHFFFAOYSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.819°C at 760 mmHg (Cal.) |
| Flash point | 234.31°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Isopropyl-P-(Isopropylsulfonyl)Benzamide |