|
CAS#: 18268-69-4 Product: 5,6-Dichlorovanillin No suppilers available for the product. |
| Name | 5,6-Dichlorovanillin |
|---|---|
| Synonyms | 2,3-Dichloro-4-Hydroxy-5-Methoxy-Benzaldehyde; 5,6-Dichlorovanillin; Benzaldehyde, 2,3-Dichloro-4-Hydroxy-5-Methoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6Cl2O3 |
| Molecular Weight | 221.04 |
| CAS Registry Number | 18268-69-4 |
| SMILES | C1=C(C(=C(Cl)C(=C1OC)O)Cl)C=O |
| InChI | 1S/C8H6Cl2O3/c1-13-5-2-4(3-11)6(9)7(10)8(5)12/h2-3,12H,1H3 |
| InChIKey | LQDPWXPJJUUISU-UHFFFAOYSA-N |
| Density | 1.499g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.924°C at 760 mmHg (Cal.) |
| Flash point | 143.656°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dichlorovanillin |