Online Database of Chemicals from Around the World
|
CAS#: 627-72-5 Product: S-(1,2-Dichlorovinyl)Cysteine No suppilers available for the product. |
| Name | S-(1,2-Dichlorovinyl)Cysteine |
|---|---|
| Synonyms | (2R)-2-Amino-3-[(Z)-1,2-Dichlorovinyl]Sulfanyl-Propanoic Acid; (2R)-2-Amino-3-[[(Z)-1,2-Dichlorovinyl]Thio]Propanoic Acid; (2R)-2-Amino-3-[[(Z)-1,2-Dichlorovinyl]Thio]Propionic Acid |
| Molecular Structure |  |
| Molecular Formula | C5H7Cl2NO2S |
| Molecular Weight | 216.08 |
| CAS Registry Number | 627-72-5 |
| SMILES | [C@H](N)(CSC(/Cl)=C/Cl)C(=O)O |
| InChI | 1S/C5H7Cl2NO2S/c6-1-4(7)11-2-3(8)5(9)10/h1,3H,2,8H2,(H,9,10)/b4-1+/t3-/m0/s1 |
| InChIKey | PJIHCWJOTSJIPQ-AGFFZDDWSA-N |
| Density | 1.545g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.69°C at 760 mmHg (Cal.) |
| Flash point | 159.239°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for S-(1,2-Dichlorovinyl)Cysteine |