Online Database of Chemicals from Around the World
| Name | Diacetoxydiethylsilane |
|---|---|
| Synonyms | (Acetoxy-Diethyl-Silyl) Acetate; Acetic Acid (Acetoxy-Diethylsilyl) Ester; Acetic Acid (Acetoxy-Diethyl-Silyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C8H16O4Si |
| Molecular Weight | 204.30 |
| CAS Registry Number | 18269-81-3 |
| EINECS | 242-150-1 |
| SMILES | C([Si](OC(=O)C)(OC(=O)C)CC)C |
| InChI | 1S/C8H16O4Si/c1-5-13(6-2,11-7(3)9)12-8(4)10/h5-6H2,1-4H3 |
| InChIKey | JQNJIBYLKBOSCM-UHFFFAOYSA-N |
| Density | 1.005g/cm3 (Cal.) |
|---|---|
| Boiling point | 208.76°C at 760 mmHg (Cal.) |
| Flash point | 66.638°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diacetoxydiethylsilane |
