Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | N-Butyl-D-Gluconamide |
|---|---|
| Synonyms | (2R,3S,4R,5R)-N-Butyl-2,3,4,5,6-Pentahydroxy-Hexanamide; Zinc04533080 |
| Molecular Structure |  |
| Molecular Formula | C10H21NO6 |
| Molecular Weight | 251.28 |
| CAS Registry Number | 18375-57-0 |
| EINECS | 242-252-6 |
| SMILES | [C@@H](CO)([C@H]([C@@H]([C@H](C(NCCCC)=O)O)O)O)O |
| InChI | 1S/C10H21NO6/c1-2-3-4-11-10(17)9(16)8(15)7(14)6(13)5-12/h6-9,12-16H,2-5H2,1H3,(H,11,17)/t6-,7-,8+,9-/m1/s1 |
| InChIKey | CRYAIAMXDBHCTJ-LURQLKTLSA-N |
| Density | 1.333g/cm3 (Cal.) |
|---|---|
| Boiling point | 635.176°C at 760 mmHg (Cal.) |
| Flash point | 337.942°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Butyl-D-Gluconamide |